About 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone
1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone (PubChem CID 126594024) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone |
| PubChem CID | 126594024 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone |
| SMILES | C=C/C=c1/cc(C(C)=O)o/c1=C/C=C |
| InChI | InChI=1S/C12H12O2/c1-4-6-10-8-12(9(3)13)14-11(10)7-5-2/h4-8H,1-2H2,3H3/b10-6-,11-7+ |
| InChIKey | IJOZNMBWUNFFNR-NAKBGQTNSA-N |
| XLogP | 1.42 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone?
The IUPAC name of 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone (CID 126594024) is 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone.
What is the SMILES notation for 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone?
The canonical SMILES for 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone is C=C/C=c1/cc(C(C)=O)o/c1=C/C=C.
What is the InChIKey of 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone?
The InChIKey is IJOZNMBWUNFFNR-NAKBGQTNSA-N. The full InChI is InChI=1S/C12H12O2/c1-4-6-10-8-12(9(3)13)14-11(10)7-5-2/h4-8H,1-2H2,3H3/b10-6-,11-7+.
What are the key properties of 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone?
1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone has a molecular weight of 188.23 g/mol, XLogP of 1.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4Z,5E)-4,5-bis(prop-2-enylidene)furan-2-yl]ethanone is sourced from PubChem (CID 126594024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).