About 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid
2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid (PubChem CID 126594048) has the molecular formula C29H28N2O3
and a molecular weight of 452.55 g/mol. Its IUPAC name is 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid.
Molecular Properties
| Compound Name | 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid |
| PubChem CID | 126594048 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid |
| SMILES | Cc1cc2nccc(-c3ccccc3C(=O)O)c2c(C)c1-c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C29H28N2O3/c1-19-17-26-28(24(11-12-30-26)23-5-3-4-6-25(23)29(32)33)20(2)27(19)22-9-7-21(8-10-22)18-31-13-15-34-16-14-31/h3-12,17H,13-16,18H2,1-2H3,(H,32,33) |
| InChIKey | VWRBLYXRMIGEKU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid?
The IUPAC name of 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid (CID 126594048) is 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid.
What is the SMILES notation for 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid?
The canonical SMILES for 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid is Cc1cc2nccc(-c3ccccc3C(=O)O)c2c(C)c1-c1ccc(CN2CCOCC2)cc1.
What is the InChIKey of 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid?
The InChIKey is VWRBLYXRMIGEKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H28N2O3/c1-19-17-26-28(24(11-12-30-26)23-5-3-4-6-25(23)29(32)33)20(2)27(19)22-9-7-21(8-10-22)18-31-13-15-34-16-14-31/h3-12,17H,13-16,18H2,1-2H3,(H,32,33).
What are the key properties of 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid?
2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid has a molecular weight of 452.55 g/mol, XLogP of 5.72, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl]benzoic acid is sourced from PubChem (CID 126594048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).