About [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate
[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate (PubChem CID 126594089) has the molecular formula C23H23F3N2O4S
and a molecular weight of 480.51 g/mol. Its IUPAC name is [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate |
| PubChem CID | 126594089 |
| Molecular Formula | C23H23F3N2O4S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc2nccc(OS(=O)(=O)C(F)(F)F)c2c(C)c1-c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C23H23F3N2O4S/c1-15-13-19-22(20(7-8-27-19)32-33(29,30)23(24,25)26)16(2)21(15)18-5-3-17(4-6-18)14-28-9-11-31-12-10-28/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | LWOYJFXKLQBUSL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate?
The IUPAC name of [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate (CID 126594089) is [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate.
What is the SMILES notation for [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate?
The canonical SMILES for [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate is Cc1cc2nccc(OS(=O)(=O)C(F)(F)F)c2c(C)c1-c1ccc(CN2CCOCC2)cc1.
What is the InChIKey of [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate?
The InChIKey is LWOYJFXKLQBUSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23F3N2O4S/c1-15-13-19-22(20(7-8-27-19)32-33(29,30)23(24,25)26)16(2)21(15)18-5-3-17(4-6-18)14-28-9-11-31-12-10-28/h3-8,13H,9-12,14H2,1-2H3.
What are the key properties of [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate?
[5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate has a molecular weight of 480.51 g/mol, XLogP of 4.58, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5,7-dimethyl-6-[4-(morpholin-4-ylmethyl)phenyl]quinolin-4-yl] trifluoromethanesulfonate is sourced from PubChem (CID 126594089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).