About (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile
(Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile (PubChem CID 126595036) has the molecular formula C10H12FN5
and a molecular weight of 221.24 g/mol. Its IUPAC name is (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile.
Molecular Properties
| Compound Name | (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile |
| PubChem CID | 126595036 |
| Molecular Formula | C10H12FN5 |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile |
| SMILES | N#CC/C(N)=C(\N)N(N)c1ccccc1F |
| InChI | InChI=1S/C10H12FN5/c11-7-3-1-2-4-9(7)16(15)10(14)8(13)5-6-12/h1-4H,5,13-15H2/b10-8- |
| InChIKey | HBXWTDXSCGXYHV-NTMALXAHSA-N |
| XLogP | 0.51 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile?
The IUPAC name of (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile (CID 126595036) is (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile.
What is the SMILES notation for (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile?
The canonical SMILES for (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile is N#CC/C(N)=C(\N)N(N)c1ccccc1F.
What is the InChIKey of (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile?
The InChIKey is HBXWTDXSCGXYHV-NTMALXAHSA-N. The full InChI is InChI=1S/C10H12FN5/c11-7-3-1-2-4-9(7)16(15)10(14)8(13)5-6-12/h1-4H,5,13-15H2/b10-8-.
What are the key properties of (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile?
(Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile has a molecular weight of 221.24 g/mol, XLogP of 0.51, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4-diamino-4-(N-amino-2-fluoroanilino)but-3-enenitrile is sourced from PubChem (CID 126595036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).