About 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine
2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine (PubChem CID 126595746) has the molecular formula C8H19N5
and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine.
Molecular Properties
| Compound Name | 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine |
| PubChem CID | 126595746 |
| Molecular Formula | C8H19N5 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine |
| SMILES | CCCC/N=C(\N)N/C=C(\N)CN |
| InChI | InChI=1S/C8H19N5/c1-2-3-4-12-8(11)13-6-7(10)5-9/h6H,2-5,9-10H2,1H3,(H3,11,12,13)/b7-6- |
| InChIKey | XURFWVIXHFJGRQ-SREVYHEPSA-N |
| XLogP | -0.55 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine?
The IUPAC name of 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine (CID 126595746) is 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine.
What is the SMILES notation for 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine?
The canonical SMILES for 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine is CCCC/N=C(\N)N/C=C(\N)CN.
What is the InChIKey of 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine?
The InChIKey is XURFWVIXHFJGRQ-SREVYHEPSA-N. The full InChI is InChI=1S/C8H19N5/c1-2-3-4-12-8(11)13-6-7(10)5-9/h6H,2-5,9-10H2,1H3,(H3,11,12,13)/b7-6-.
What are the key properties of 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine?
2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine has a molecular weight of 185.27 g/mol, XLogP of -0.55, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1-[(Z)-2,3-diaminoprop-1-enyl]guanidine is sourced from PubChem (CID 126595746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).