C18H17F2NO4 — CID 126595914
8-(2-ethoxyphenyl)-2,2-difluoro-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinolin-6-ol (PubChem CID 126595914) has the molecular formula C18H17F2NO4 and a molecular weight of 349.33 g/mol. Its IUPAC name is 8-(2-ethoxyphenyl)-2,2-difluoro-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinolin-6-ol.
| Compound Name | 8-(2-ethoxyphenyl)-2,2-difluoro-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinolin-6-ol |
|---|---|
| PubChem CID | 126595914 |
| Molecular Formula | C18H17F2NO4 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 8-(2-ethoxyphenyl)-2,2-difluoro-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinolin-6-ol |
| SMILES | CCOc1ccccc1C1CC(O)Nc2cc3c(cc21)OC(F)(F)O3 |
| InChI | InChI=1S/C18H17F2NO4/c1-2-23-14-6-4-3-5-10(14)11-8-17(22)21-13-9-16-15(7-12(11)13)24-18(19,20)25-16/h3-7,9,11,17,21-22H,2,8H2,1H3 |
| InChIKey | NZUKQVHHIIPVLL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|