About (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile
(3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile (PubChem CID 126595988) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile.
Molecular Properties
| Compound Name | (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile |
| PubChem CID | 126595988 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile |
| SMILES | CC/C=C\C=C(/CC)C(F)C#N |
| InChI | InChI=1S/C10H14FN/c1-3-5-6-7-9(4-2)10(11)8-12/h5-7,10H,3-4H2,1-2H3/b6-5-,9-7+ |
| InChIKey | XIKHISUJBROZOF-BZWSEGBZSA-N |
| XLogP | 3.15 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile?
The IUPAC name of (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile (CID 126595988) is (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile.
What is the SMILES notation for (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile?
The canonical SMILES for (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile is CC/C=C\C=C(/CC)C(F)C#N.
What is the InChIKey of (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile?
The InChIKey is XIKHISUJBROZOF-BZWSEGBZSA-N. The full InChI is InChI=1S/C10H14FN/c1-3-5-6-7-9(4-2)10(11)8-12/h5-7,10H,3-4H2,1-2H3/b6-5-,9-7+.
What are the key properties of (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile?
(3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile has a molecular weight of 167.23 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-3-ethyl-2-fluoroocta-3,5-dienenitrile is sourced from PubChem (CID 126595988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).