C19H19F2NO4 — CID 126596105
2,2-difluoro-8-(2-propoxyphenyl)-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinolin-6-ol (PubChem CID 126596105) has the molecular formula C19H19F2NO4 and a molecular weight of 363.36 g/mol. Its IUPAC name is 2,2-difluoro-8-(2-propoxyphenyl)-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinolin-6-ol.
| Compound Name | 2,2-difluoro-8-(2-propoxyphenyl)-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinolin-6-ol |
|---|---|
| PubChem CID | 126596105 |
| Molecular Formula | C19H19F2NO4 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2,2-difluoro-8-(2-propoxyphenyl)-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinolin-6-ol |
| SMILES | CCCOc1ccccc1C1CC(O)Nc2cc3c(cc21)OC(F)(F)O3 |
| InChI | InChI=1S/C19H19F2NO4/c1-2-7-24-15-6-4-3-5-11(15)12-9-18(23)22-14-10-17-16(8-13(12)14)25-19(20,21)26-17/h3-6,8,10,12,18,22-23H,2,7,9H2,1H3 |
| InChIKey | PXXHWNDLWHYGAT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|