C20H27N2O6P — CID 126596412
(R)-[(2R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;phosphoric acid (PubChem CID 126596412) has the molecular formula C20H27N2O6P and a molecular weight of 422.42 g/mol. Its IUPAC name is (R)-[(2R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;phosphoric acid.
| Compound Name | (R)-[(2R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;phosphoric acid |
|---|---|
| PubChem CID | 126596412 |
| Molecular Formula | C20H27N2O6P |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (R)-[(2R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;phosphoric acid |
| SMILES | C=C[C@@H]1CN2CCC1C[C@@H]2[C@H](O)c1ccnc2ccc(OC)cc12.O=P(O)(O)O |
| InChI | InChI=1S/C20H24N2O2.H3O4P/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;1-5(2,3)4/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;(H3,1,2,3,4)/t13-,14?,19-,20-;/m1./s1 |
| InChIKey | YONMXAODZKOTLR-ZSPVSSIQSA-N |
| XLogP | 2.24 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|