About N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine
N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine (PubChem CID 126597376) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine |
| PubChem CID | 126597376 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine |
| SMILES | C=NCCN(CC1=CC=CCC1)CC(C)C |
| InChI | InChI=1S/C14H24N2/c1-13(2)11-16(10-9-15-3)12-14-7-5-4-6-8-14/h4-5,7,13H,3,6,8-12H2,1-2H3 |
| InChIKey | XWHPUKRBWRDGON-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine?
The IUPAC name of N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine (CID 126597376) is N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine.
What is the SMILES notation for N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine?
The canonical SMILES for N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine is C=NCCN(CC1=CC=CCC1)CC(C)C.
What is the InChIKey of N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine?
The InChIKey is XWHPUKRBWRDGON-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2/c1-13(2)11-16(10-9-15-3)12-14-7-5-4-6-8-14/h4-5,7,13H,3,6,8-12H2,1-2H3.
What are the key properties of N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine?
N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine has a molecular weight of 220.36 g/mol, XLogP of 2.92, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-1,3-dien-1-ylmethyl)-2-methyl-N-[2-(methylideneamino)ethyl]propan-1-amine is sourced from PubChem (CID 126597376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).