About [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate
[2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate (PubChem CID 126597821) has the molecular formula C20H22N6O3
and a molecular weight of 394.44 g/mol. Its IUPAC name is [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate |
| PubChem CID | 126597821 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)Oc1c[nH]c2ncc(-c3nn(C)c4ccc(C(C)O)cc34)nc12 |
| InChI | InChI=1S/C20H22N6O3/c1-10(2)23-20(28)29-16-9-22-19-18(16)24-14(8-21-19)17-13-7-12(11(3)27)5-6-15(13)26(4)25-17/h5-11,27H,1-4H3,(H,21,22)(H,23,28) |
| InChIKey | IFIJCVGWRFZLDB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate?
The IUPAC name of [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate (CID 126597821) is [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate.
What is the SMILES notation for [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate?
The canonical SMILES for [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate is CC(C)NC(=O)Oc1c[nH]c2ncc(-c3nn(C)c4ccc(C(C)O)cc34)nc12.
What is the InChIKey of [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate?
The InChIKey is IFIJCVGWRFZLDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N6O3/c1-10(2)23-20(28)29-16-9-22-19-18(16)24-14(8-21-19)17-13-7-12(11(3)27)5-6-15(13)26(4)25-17/h5-11,27H,1-4H3,(H,21,22)(H,23,28).
What are the key properties of [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate?
[2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate has a molecular weight of 394.44 g/mol, XLogP of 3.06, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[5-(1-hydroxyethyl)-1-methylindazol-3-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl] N-propan-2-ylcarbamate is sourced from PubChem (CID 126597821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).