C22H19F3N2O4 — CID 126598523
methyl 2-methoxy-5-[6-[[3-(trifluoromethoxy)phenyl]methylamino]-3-pyridinyl]benzoate (PubChem CID 126598523) has the molecular formula C22H19F3N2O4 and a molecular weight of 432.40 g/mol. Its IUPAC name is methyl 2-methoxy-5-[6-[[3-(trifluoromethoxy)phenyl]methylamino]-3-pyridinyl]benzoate.
| Compound Name | methyl 2-methoxy-5-[6-[[3-(trifluoromethoxy)phenyl]methylamino]-3-pyridinyl]benzoate |
|---|---|
| PubChem CID | 126598523 |
| Molecular Formula | C22H19F3N2O4 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | methyl 2-methoxy-5-[6-[[3-(trifluoromethoxy)phenyl]methylamino]-3-pyridinyl]benzoate |
| SMILES | COC(=O)c1cc(-c2ccc(NCc3cccc(OC(F)(F)F)c3)nc2)ccc1OC |
| InChI | InChI=1S/C22H19F3N2O4/c1-29-19-8-6-15(11-18(19)21(28)30-2)16-7-9-20(27-13-16)26-12-14-4-3-5-17(10-14)31-22(23,24)25/h3-11,13H,12H2,1-2H3,(H,26,27) |
| InChIKey | FFPPSPSXZCYRCU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |