C8H12N2 — CID 126598753
[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]hydrazine (PubChem CID 126598753) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]hydrazine.
| Compound Name | [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]hydrazine |
|---|---|
| PubChem CID | 126598753 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]hydrazine |
| SMILES | C=C/C=C\C(=C/C=C)NN |
| InChI | InChI=1S/C8H12N2/c1-3-5-7-8(10-9)6-4-2/h3-7,10H,1-2,9H2/b7-5-,8-6+ |
| InChIKey | FWIBRKSTLSDJCG-CGXWXWIYSA-N |
| XLogP | 1.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|