About (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol
(1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol (PubChem CID 126599171) has the molecular formula C9H16O3S
and a molecular weight of 204.29 g/mol. Its IUPAC name is (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol.
Molecular Properties
| Compound Name | (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol |
| PubChem CID | 126599171 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol |
| SMILES | C=CC[C@H](O)[C@H]1O[C@@H](C)C[C@@H]1OS |
| InChI | InChI=1S/C9H16O3S/c1-3-4-7(10)9-8(12-13)5-6(2)11-9/h3,6-10,13H,1,4-5H2,2H3/t6-,7-,8-,9+/m0/s1 |
| InChIKey | SPSPKHJDFBVJSG-XSPKLOCKSA-N |
| XLogP | 1.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol?
The IUPAC name of (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol (CID 126599171) is (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol.
What is the SMILES notation for (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol?
The canonical SMILES for (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol is C=CC[C@H](O)[C@H]1O[C@@H](C)C[C@@H]1OS.
What is the InChIKey of (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol?
The InChIKey is SPSPKHJDFBVJSG-XSPKLOCKSA-N. The full InChI is InChI=1S/C9H16O3S/c1-3-4-7(10)9-8(12-13)5-6(2)11-9/h3,6-10,13H,1,4-5H2,2H3/t6-,7-,8-,9+/m0/s1.
What are the key properties of (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol?
(1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol has a molecular weight of 204.29 g/mol, XLogP of 1.33, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(2R,3S,5S)-5-methyl-3-sulfanyloxyoxolan-2-yl]but-3-en-1-ol is sourced from PubChem (CID 126599171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).