C14H25N3 — CID 126599338
6-(2,3-dimethylpent-4-enyl)-4-propyl-1,4-dihydropyrimidin-5-amine (PubChem CID 126599338) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 6-(2,3-dimethylpent-4-enyl)-4-propyl-1,4-dihydropyrimidin-5-amine.
| Compound Name | 6-(2,3-dimethylpent-4-enyl)-4-propyl-1,4-dihydropyrimidin-5-amine |
|---|---|
| PubChem CID | 126599338 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 6-(2,3-dimethylpent-4-enyl)-4-propyl-1,4-dihydropyrimidin-5-amine |
| SMILES | C=CC(C)C(C)CC1=C(N)C(CCC)N=CN1 |
| InChI | InChI=1S/C14H25N3/c1-5-7-12-14(15)13(17-9-16-12)8-11(4)10(3)6-2/h6,9-12H,2,5,7-8,15H2,1,3-4H3,(H,16,17) |
| InChIKey | HFATXYVCMSGULO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|