C12H23N3 — CID 126599359
(3Z,5Z)-2-imino-4-N-methyl-4-N-(2-methylpropyl)hepta-3,5-diene-3,4-diamine (PubChem CID 126599359) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is (3Z,5Z)-2-imino-4-N-methyl-4-N-(2-methylpropyl)hepta-3,5-diene-3,4-diamine.
| Compound Name | (3Z,5Z)-2-imino-4-N-methyl-4-N-(2-methylpropyl)hepta-3,5-diene-3,4-diamine |
|---|---|
| PubChem CID | 126599359 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (3Z,5Z)-2-imino-4-N-methyl-4-N-(2-methylpropyl)hepta-3,5-diene-3,4-diamine |
| SMILES | [H]/N=C(C)/C(N)=C(\C=C/C)N(C)CC(C)C |
| InChI | InChI=1S/C12H23N3/c1-6-7-11(12(14)10(4)13)15(5)8-9(2)3/h6-7,9,13H,8,14H2,1-5H3/b7-6-,12-11-,13-10+ |
| InChIKey | NBZJTUYMMDLWIF-GQLOHTCQSA-N |
| XLogP | 2.36 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|