C15H27N5O4S2 — CID 126599992
2-[[2-amino-6-[3-(propyldisulfanyl)propoxy]-3,6-dihydropurin-9-yl]methoxy]propane-1,3-diol (PubChem CID 126599992) has the molecular formula C15H27N5O4S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 2-[[2-amino-6-[3-(propyldisulfanyl)propoxy]-3,6-dihydropurin-9-yl]methoxy]propane-1,3-diol.
| Compound Name | 2-[[2-amino-6-[3-(propyldisulfanyl)propoxy]-3,6-dihydropurin-9-yl]methoxy]propane-1,3-diol |
|---|---|
| PubChem CID | 126599992 |
| Molecular Formula | C15H27N5O4S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[[2-amino-6-[3-(propyldisulfanyl)propoxy]-3,6-dihydropurin-9-yl]methoxy]propane-1,3-diol |
| SMILES | CCCSSCCCOC1N=C(N)Nc2c1ncn2COC(CO)CO |
| InChI | InChI=1S/C15H27N5O4S2/c1-2-5-25-26-6-3-4-23-14-12-13(18-15(16)19-14)20(9-17-12)10-24-11(7-21)8-22/h9,11,14,21-22H,2-8,10H2,1H3,(H3,16,18,19) |
| InChIKey | TZUPZVJCUZAASU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|