About (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid
(2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid (PubChem CID 126600651) has the molecular formula C4H4FO3P
and a molecular weight of 150.04 g/mol. Its IUPAC name is (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid.
Molecular Properties
| Compound Name | (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid |
| PubChem CID | 126600651 |
| Molecular Formula | C4H4FO3P |
| Molecular Weight | 150.04 g/mol |
| Exact Mass | 149.99 |
| IUPAC Name | (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid |
| SMILES | O=P#CC[C@@H](F)C(=O)O |
| InChI | InChI=1S/C4H4FO3P/c5-3(4(6)7)1-2-9-8/h3H,1H2,(H,6,7)/t3-/m1/s1 |
| InChIKey | BRTVTRVNGIJZKW-GSVOUGTGSA-N |
| XLogP | 1.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.04 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid?
The IUPAC name of (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid (CID 126600651) is (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid.
What is the SMILES notation for (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid?
The canonical SMILES for (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid is O=P#CC[C@@H](F)C(=O)O.
What is the InChIKey of (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid?
The InChIKey is BRTVTRVNGIJZKW-GSVOUGTGSA-N. The full InChI is InChI=1S/C4H4FO3P/c5-3(4(6)7)1-2-9-8/h3H,1H2,(H,6,7)/t3-/m1/s1.
What are the key properties of (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid?
(2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid has a molecular weight of 150.04 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-fluoro-4-(oxo-λ5-phosphanylidyne)butanoic acid is sourced from PubChem (CID 126600651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).