(1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid

C6H9NO2S — CID 126601340

IUPAC(1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid
SMILESO=C(O)N1C[C@@H]2C[C@H]1CS2
InChIInChI=1S/C6H9NO2S/c8-6(9)7-2-5-1-4(7)3-10-5/h4-5H,1-3H2,(H,8,9)/t4-,5-/m0/s1
InChIKeyIZYPROHDMSOKMH-WHFBIAKZSA-N
MW159.21 g/mol
LogP0.85
Rot. Bonds

About (1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid

(1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid (PubChem CID 126601340) has the molecular formula C6H9NO2S and a molecular weight of 159.21 g/mol. Its IUPAC name is (1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid.

Molecular Properties

Compound Name(1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid
PubChem CID126601340
Molecular FormulaC6H9NO2S
Molecular Weight159.21 g/mol
Exact Mass159.04
IUPAC Name(1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid
SMILESO=C(O)N1C[C@@H]2C[C@H]1CS2
InChIInChI=1S/C6H9NO2S/c8-6(9)7-2-5-1-4(7)3-10-5/h4-5H,1-3H2,(H,8,9)/t4-,5-/m0/s1
InChIKeyIZYPROHDMSOKMH-WHFBIAKZSA-N
XLogP0.85
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.21
LogP ≤ 50.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid?
The IUPAC name of (1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid (CID 126601340) is (1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid.
What is the SMILES notation for (1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid?
The canonical SMILES for (1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid is O=C(O)N1C[C@@H]2C[C@H]1CS2.
What is the InChIKey of (1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid?
The InChIKey is IZYPROHDMSOKMH-WHFBIAKZSA-N. The full InChI is InChI=1S/C6H9NO2S/c8-6(9)7-2-5-1-4(7)3-10-5/h4-5H,1-3H2,(H,8,9)/t4-,5-/m0/s1.
What are the key properties of (1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid?
(1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid has a molecular weight of 159.21 g/mol, XLogP of 0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4S)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylic acid is sourced from PubChem (CID 126601340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).