C15H26N2 — CID 126601347
2,6-dimethyl-5,6-di(propan-2-yl)cyclohexa-2,4-diene-1-carboximidamide (PubChem CID 126601347) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 2,6-dimethyl-5,6-di(propan-2-yl)cyclohexa-2,4-diene-1-carboximidamide.
| Compound Name | 2,6-dimethyl-5,6-di(propan-2-yl)cyclohexa-2,4-diene-1-carboximidamide |
|---|---|
| PubChem CID | 126601347 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 2,6-dimethyl-5,6-di(propan-2-yl)cyclohexa-2,4-diene-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1C(C)=CC=C(C(C)C)C1(C)C(C)C |
| InChI | InChI=1S/C15H26N2/c1-9(2)12-8-7-11(5)13(14(16)17)15(12,6)10(3)4/h7-10,13H,1-6H3,(H3,16,17) |
| InChIKey | LMCILGLZQRQUNC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|