C22H23N5O2 — CID 126601415
N-hydroxy-3-phenyl-2-[5-(1,3,5-trimethylpyrazol-4-yl)indazol-1-yl]propanamide (PubChem CID 126601415) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-hydroxy-3-phenyl-2-[5-(1,3,5-trimethylpyrazol-4-yl)indazol-1-yl]propanamide.
| Compound Name | N-hydroxy-3-phenyl-2-[5-(1,3,5-trimethylpyrazol-4-yl)indazol-1-yl]propanamide |
|---|---|
| PubChem CID | 126601415 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-hydroxy-3-phenyl-2-[5-(1,3,5-trimethylpyrazol-4-yl)indazol-1-yl]propanamide |
| SMILES | Cc1nn(C)c(C)c1-c1ccc2c(cnn2C(Cc2ccccc2)C(=O)NO)c1 |
| InChI | InChI=1S/C22H23N5O2/c1-14-21(15(2)26(3)24-14)17-9-10-19-18(12-17)13-23-27(19)20(22(28)25-29)11-16-7-5-4-6-8-16/h4-10,12-13,20,29H,11H2,1-3H3,(H,25,28) |
| InChIKey | BNQJVRDNHPTMBN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|