About 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde
2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde (PubChem CID 126601684) has the molecular formula C15H12Br2O3
and a molecular weight of 400.07 g/mol. Its IUPAC name is 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde.
Molecular Properties
| Compound Name | 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde |
| PubChem CID | 126601684 |
| Molecular Formula | C15H12Br2O3 |
| Molecular Weight | 400.07 g/mol |
| Exact Mass | 397.92 |
| IUPAC Name | 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(-c2cc(Br)cc(Br)c2)c(OC)c1 |
| InChI | InChI=1S/C15H12Br2O3/c1-19-13-5-10(8-18)15(14(7-13)20-2)9-3-11(16)6-12(17)4-9/h3-8H,1-2H3 |
| InChIKey | UVMADZRILHFVTJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.07 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde?
The IUPAC name of 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde (CID 126601684) is 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde.
What is the SMILES notation for 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde?
The canonical SMILES for 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde is COc1cc(C=O)c(-c2cc(Br)cc(Br)c2)c(OC)c1.
What is the InChIKey of 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde?
The InChIKey is UVMADZRILHFVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Br2O3/c1-19-13-5-10(8-18)15(14(7-13)20-2)9-3-11(16)6-12(17)4-9/h3-8H,1-2H3.
What are the key properties of 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde?
2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde has a molecular weight of 400.07 g/mol, XLogP of 4.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dibromophenyl)-3,5-dimethoxybenzaldehyde is sourced from PubChem (CID 126601684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).