C27H35N5O3 — CID 126601773
2-[[4-[5,7-bis[(3S)-3-methylmorpholin-4-yl]-1,8-naphthyridin-2-yl]phenyl]methylamino]ethanol (PubChem CID 126601773) has the molecular formula C27H35N5O3 and a molecular weight of 477.61 g/mol. Its IUPAC name is 2-[[4-[5,7-bis[(3S)-3-methylmorpholin-4-yl]-1,8-naphthyridin-2-yl]phenyl]methylamino]ethanol.
| Compound Name | 2-[[4-[5,7-bis[(3S)-3-methylmorpholin-4-yl]-1,8-naphthyridin-2-yl]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 126601773 |
| Molecular Formula | C27H35N5O3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 2-[[4-[5,7-bis[(3S)-3-methylmorpholin-4-yl]-1,8-naphthyridin-2-yl]phenyl]methylamino]ethanol |
| SMILES | C[C@H]1COCCN1c1cc(N2CCOC[C@@H]2C)c2ccc(-c3ccc(CNCCO)cc3)nc2n1 |
| InChI | InChI=1S/C27H35N5O3/c1-19-17-34-13-10-31(19)25-15-26(32-11-14-35-18-20(32)2)30-27-23(25)7-8-24(29-27)22-5-3-21(4-6-22)16-28-9-12-33/h3-8,15,19-20,28,33H,9-14,16-18H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | WGBZONARTMXJQI-PMACEKPBSA-N |
| XLogP | 2.83 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|