C25H30N4O3 — CID 126601785
[3-[5,7-bis[(3S)-3-methylmorpholin-4-yl]-1,6-naphthyridin-2-yl]phenyl]methanol (PubChem CID 126601785) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is [3-[5,7-bis[(3S)-3-methylmorpholin-4-yl]-1,6-naphthyridin-2-yl]phenyl]methanol.
| Compound Name | [3-[5,7-bis[(3S)-3-methylmorpholin-4-yl]-1,6-naphthyridin-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 126601785 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [3-[5,7-bis[(3S)-3-methylmorpholin-4-yl]-1,6-naphthyridin-2-yl]phenyl]methanol |
| SMILES | C[C@H]1COCCN1c1cc2nc(-c3cccc(CO)c3)ccc2c(N2CCOC[C@@H]2C)n1 |
| InChI | InChI=1S/C25H30N4O3/c1-17-15-31-10-8-28(17)24-13-23-21(25(27-24)29-9-11-32-16-18(29)2)6-7-22(26-23)20-5-3-4-19(12-20)14-30/h3-7,12-13,17-18,30H,8-11,14-16H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | JNQXWDGTUMWKBX-ROUUACIJSA-N |
| XLogP | 3.24 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |