C16H25N3O7S — CID 126602038
2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;2-phenyl-2-sulfamoylacetic acid (PubChem CID 126602038) has the molecular formula C16H25N3O7S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;2-phenyl-2-sulfamoylacetic acid.
| Compound Name | 2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;2-phenyl-2-sulfamoylacetic acid |
|---|---|
| PubChem CID | 126602038 |
| Molecular Formula | C16H25N3O7S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;2-phenyl-2-sulfamoylacetic acid |
| SMILES | CC(C)CC(NC(=O)CN)C(=O)O.NS(=O)(=O)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C8H16N2O3.C8H9NO4S/c1-5(2)3-6(8(12)13)10-7(11)4-9;9-14(12,13)7(8(10)11)6-4-2-1-3-5-6/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13);1-5,7H,(H,10,11)(H2,9,12,13) |
| InChIKey | CHXGQUPCOVQKEU-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 189.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |