About [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine
[5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine (PubChem CID 126602269) has the molecular formula C13H8BrF6NO
and a molecular weight of 388.11 g/mol. Its IUPAC name is [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine |
| PubChem CID | 126602269 |
| Molecular Formula | C13H8BrF6NO |
| Molecular Weight | 388.11 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine |
| SMILES | NCc1ccc(-c2c(C(F)(F)F)cc(Br)cc2C(F)(F)F)o1 |
| InChI | InChI=1S/C13H8BrF6NO/c14-6-3-8(12(15,16)17)11(9(4-6)13(18,19)20)10-2-1-7(5-21)22-10/h1-4H,5,21H2 |
| InChIKey | HTYJZYGGDBHRRE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.11 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine?
The IUPAC name of [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine (CID 126602269) is [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine.
What is the SMILES notation for [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine?
The canonical SMILES for [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine is NCc1ccc(-c2c(C(F)(F)F)cc(Br)cc2C(F)(F)F)o1.
What is the InChIKey of [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine?
The InChIKey is HTYJZYGGDBHRRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrF6NO/c14-6-3-8(12(15,16)17)11(9(4-6)13(18,19)20)10-2-1-7(5-21)22-10/h1-4H,5,21H2.
What are the key properties of [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine?
[5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine has a molecular weight of 388.11 g/mol, XLogP of 5.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[4-bromo-2,6-bis(trifluoromethyl)phenyl]furan-2-yl]methanamine is sourced from PubChem (CID 126602269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).