C24H37N — CID 126602783
(Z,6E)-7-(1-but-1-enyl-2-methylcyclopropyl)-N-ethenyl-6-ethylidene-4-propan-2-ylidenenon-2-en-5-imine (PubChem CID 126602783) has the molecular formula C24H37N and a molecular weight of 339.57 g/mol. Its IUPAC name is (Z,6E)-7-(1-but-1-enyl-2-methylcyclopropyl)-N-ethenyl-6-ethylidene-4-propan-2-ylidenenon-2-en-5-imine.
| Compound Name | (Z,6E)-7-(1-but-1-enyl-2-methylcyclopropyl)-N-ethenyl-6-ethylidene-4-propan-2-ylidenenon-2-en-5-imine |
|---|---|
| PubChem CID | 126602783 |
| Molecular Formula | C24H37N |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | (Z,6E)-7-(1-but-1-enyl-2-methylcyclopropyl)-N-ethenyl-6-ethylidene-4-propan-2-ylidenenon-2-en-5-imine |
| SMILES | C=C/N=C(C(/C=C\C)=C(C)C)/C(=C/C)C(CC)C1(C=CCC)CC1C |
| InChI | InChI=1S/C24H37N/c1-9-14-16-24(17-19(24)8)22(12-4)20(11-3)23(25-13-5)21(15-10-2)18(6)7/h10-11,13-16,19,22H,5,9,12,17H2,1-4,6-8H3/b15-10-,16-14?,20-11+,25-23- |
| InChIKey | MHOBHAHDOOSVMP-NVAJEQTNSA-N |
| XLogP | 7.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|