C21H25F2N3O3S2 — CID 126602954
(1R,2R,5S)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(fluoromethyl)-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide (PubChem CID 126602954) has the molecular formula C21H25F2N3O3S2 and a molecular weight of 469.58 g/mol. Its IUPAC name is (1R,2R,5S)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(fluoromethyl)-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide.
| Compound Name | (1R,2R,5S)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(fluoromethyl)-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 126602954 |
| Molecular Formula | C21H25F2N3O3S2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | (1R,2R,5S)-2-[5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-(fluoromethyl)-1,3-thiazol-4-yl]-5-fluorocyclohexane-1-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H](F)CC[C@H]1c1nc(CF)sc1-c1ccc(N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C21H25F2N3O3S2/c22-12-18-25-19(16-6-3-14(23)11-17(16)21(24)27)20(30-18)13-1-4-15(5-2-13)26-7-9-31(28,29)10-8-26/h1-2,4-5,14,16-17H,3,6-12H2,(H2,24,27)/t14-,16+,17+/m0/s1 |
| InChIKey | LPTSXSRRVVMDBQ-USXIJHARSA-N |
| XLogP | 3.22 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |