C18H21Cl2N3 — CID 126603042
1-N-[2-[4-[(1Z)-buta-1,3-dienyl]-2,5-dimethyl-1H-pyrrol-3-yl]ethyl]-2,6-dichlorobenzene-1,4-diamine (PubChem CID 126603042) has the molecular formula C18H21Cl2N3 and a molecular weight of 350.29 g/mol. Its IUPAC name is 1-N-[2-[4-[(1Z)-buta-1,3-dienyl]-2,5-dimethyl-1H-pyrrol-3-yl]ethyl]-2,6-dichlorobenzene-1,4-diamine.
| Compound Name | 1-N-[2-[4-[(1Z)-buta-1,3-dienyl]-2,5-dimethyl-1H-pyrrol-3-yl]ethyl]-2,6-dichlorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 126603042 |
| Molecular Formula | C18H21Cl2N3 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1-N-[2-[4-[(1Z)-buta-1,3-dienyl]-2,5-dimethyl-1H-pyrrol-3-yl]ethyl]-2,6-dichlorobenzene-1,4-diamine |
| SMILES | C=C/C=C\c1c(C)[nH]c(C)c1CCNc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C18H21Cl2N3/c1-4-5-6-14-11(2)23-12(3)15(14)7-8-22-18-16(19)9-13(21)10-17(18)20/h4-6,9-10,22-23H,1,7-8,21H2,2-3H3/b6-5- |
| InChIKey | CGKXFJWVVVUBOK-WAYWQWQTSA-N |
| XLogP | 5.37 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|