C24H22FN3O7 — CID 126603200
methyl 3-(ethoxymethoxy)-5-[(4-fluorophenyl)methoxy]-2-(2-methyl-1,2,4-triazol-3-yl)-4-oxochromene-7-carboxylate (PubChem CID 126603200) has the molecular formula C24H22FN3O7 and a molecular weight of 483.45 g/mol. Its IUPAC name is methyl 3-(ethoxymethoxy)-5-[(4-fluorophenyl)methoxy]-2-(2-methyl-1,2,4-triazol-3-yl)-4-oxochromene-7-carboxylate.
| Compound Name | methyl 3-(ethoxymethoxy)-5-[(4-fluorophenyl)methoxy]-2-(2-methyl-1,2,4-triazol-3-yl)-4-oxochromene-7-carboxylate |
|---|---|
| PubChem CID | 126603200 |
| Molecular Formula | C24H22FN3O7 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | methyl 3-(ethoxymethoxy)-5-[(4-fluorophenyl)methoxy]-2-(2-methyl-1,2,4-triazol-3-yl)-4-oxochromene-7-carboxylate |
| SMILES | CCOCOc1c(-c2ncnn2C)oc2cc(C(=O)OC)cc(OCc3ccc(F)cc3)c2c1=O |
| InChI | InChI=1S/C24H22FN3O7/c1-4-32-13-34-21-20(29)19-17(33-11-14-5-7-16(25)8-6-14)9-15(24(30)31-3)10-18(19)35-22(21)23-26-12-27-28(23)2/h5-10,12H,4,11,13H2,1-3H3 |
| InChIKey | DJJITWZAGAKZLW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 114.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|