C19H26N2O5 — CID 126603282
2-[[3-butoxy-5-[(1S)-1-[ethyl(methyl)amino]prop-2-enyl]-1,2-oxazol-4-yl]-hydroxymethyl]furan-3-carbaldehyde (PubChem CID 126603282) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[[3-butoxy-5-[(1S)-1-[ethyl(methyl)amino]prop-2-enyl]-1,2-oxazol-4-yl]-hydroxymethyl]furan-3-carbaldehyde.
| Compound Name | 2-[[3-butoxy-5-[(1S)-1-[ethyl(methyl)amino]prop-2-enyl]-1,2-oxazol-4-yl]-hydroxymethyl]furan-3-carbaldehyde |
|---|---|
| PubChem CID | 126603282 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[[3-butoxy-5-[(1S)-1-[ethyl(methyl)amino]prop-2-enyl]-1,2-oxazol-4-yl]-hydroxymethyl]furan-3-carbaldehyde |
| SMILES | C=C[C@@H](c1onc(OCCCC)c1C(O)c1occc1C=O)N(C)CC |
| InChI | InChI=1S/C19H26N2O5/c1-5-8-10-25-19-15(16(23)17-13(12-22)9-11-24-17)18(26-20-19)14(6-2)21(4)7-3/h6,9,11-12,14,16,23H,2,5,7-8,10H2,1,3-4H3/t14-,16?/m0/s1 |
| InChIKey | KGUMDHYIRUENRS-LBAUFKAWSA-N |
| XLogP | 3.52 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|