About N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide
N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide (PubChem CID 126603452) has the molecular formula C14H15ClFN3S
and a molecular weight of 311.81 g/mol. Its IUPAC name is N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide.
Molecular Properties
| Compound Name | N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide |
| PubChem CID | 126603452 |
| Molecular Formula | C14H15ClFN3S |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide |
| SMILES | CC[C@@H](N/C(=N/C)c1nccs1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H15ClFN3S/c1-3-12(10-5-4-9(16)8-11(10)15)19-13(17-2)14-18-6-7-20-14/h4-8,12H,3H2,1-2H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | CVMNCAASDMGNKJ-GFCCVEGCSA-N |
| XLogP | 4.05 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide?
The IUPAC name of N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide (CID 126603452) is N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide.
What is the SMILES notation for N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide?
The canonical SMILES for N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide is CC[C@@H](N/C(=N/C)c1nccs1)c1ccc(F)cc1Cl.
What is the InChIKey of N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide?
The InChIKey is CVMNCAASDMGNKJ-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H15ClFN3S/c1-3-12(10-5-4-9(16)8-11(10)15)19-13(17-2)14-18-6-7-20-14/h4-8,12H,3H2,1-2H3,(H,17,19)/t12-/m1/s1.
What are the key properties of N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide?
N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide has a molecular weight of 311.81 g/mol, XLogP of 4.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(2-chloro-4-fluorophenyl)propyl]-N'-methyl-1,3-thiazole-2-carboximidamide is sourced from PubChem (CID 126603452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).