About 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal
2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal (PubChem CID 126603538) has the molecular formula C6H14N2O5
and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal.
Molecular Properties
| Compound Name | 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal |
| PubChem CID | 126603538 |
| Molecular Formula | C6H14N2O5 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal |
| SMILES | NNC[C@@H](O)[C@H](O)OC(C=O)CO |
| InChI | InChI=1S/C6H14N2O5/c7-8-1-5(11)6(12)13-4(2-9)3-10/h2,4-6,8,10-12H,1,3,7H2/t4?,5-,6-/m1/s1 |
| InChIKey | BMTBRSBOWMAEMG-YSLANXFLSA-N |
| XLogP | -3.29 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal?
The IUPAC name of 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal (CID 126603538) is 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal.
What is the SMILES notation for 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal?
The canonical SMILES for 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal is NNC[C@@H](O)[C@H](O)OC(C=O)CO.
What is the InChIKey of 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal?
The InChIKey is BMTBRSBOWMAEMG-YSLANXFLSA-N. The full InChI is InChI=1S/C6H14N2O5/c7-8-1-5(11)6(12)13-4(2-9)3-10/h2,4-6,8,10-12H,1,3,7H2/t4?,5-,6-/m1/s1.
What are the key properties of 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal?
2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal has a molecular weight of 194.19 g/mol, XLogP of -3.29, 7 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2R)-3-hydrazinyl-1,2-dihydroxypropoxy]-3-hydroxypropanal is sourced from PubChem (CID 126603538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).