C25H24F2N2O5 — CID 126603561
methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-hydroxy-3-phenylmethoxy-1-prop-2-enyl-4H-pyridine-2-carboxylate (PubChem CID 126603561) has the molecular formula C25H24F2N2O5 and a molecular weight of 470.47 g/mol. Its IUPAC name is methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-hydroxy-3-phenylmethoxy-1-prop-2-enyl-4H-pyridine-2-carboxylate.
| Compound Name | methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-hydroxy-3-phenylmethoxy-1-prop-2-enyl-4H-pyridine-2-carboxylate |
|---|---|
| PubChem CID | 126603561 |
| Molecular Formula | C25H24F2N2O5 |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-hydroxy-3-phenylmethoxy-1-prop-2-enyl-4H-pyridine-2-carboxylate |
| SMILES | C=CCN1C=C(C(=O)NCc2ccc(F)cc2F)C(O)C(OCc2ccccc2)=C1C(=O)OC |
| InChI | InChI=1S/C25H24F2N2O5/c1-3-11-29-14-19(24(31)28-13-17-9-10-18(26)12-20(17)27)22(30)23(21(29)25(32)33-2)34-15-16-7-5-4-6-8-16/h3-10,12,14,22,30H,1,11,13,15H2,2H3,(H,28,31) |
| InChIKey | JDJQCZBPEJVHLM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|