C25H27F2N5O2S2 — CID 126603744
N-[1-[2-[[(E)-2-cyano-3-(2,2-dimethylpropylsulfanyl)prop-2-enoyl]-methylamino]ethyl]benzimidazol-2-yl]-5-(difluoromethyl)thiophene-2-carboxamide (PubChem CID 126603744) has the molecular formula C25H27F2N5O2S2 and a molecular weight of 531.65 g/mol. Its IUPAC name is N-[1-[2-[[(E)-2-cyano-3-(2,2-dimethylpropylsulfanyl)prop-2-enoyl]-methylamino]ethyl]benzimidazol-2-yl]-5-(difluoromethyl)thiophene-2-carboxamide.
| Compound Name | N-[1-[2-[[(E)-2-cyano-3-(2,2-dimethylpropylsulfanyl)prop-2-enoyl]-methylamino]ethyl]benzimidazol-2-yl]-5-(difluoromethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126603744 |
| Molecular Formula | C25H27F2N5O2S2 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | N-[1-[2-[[(E)-2-cyano-3-(2,2-dimethylpropylsulfanyl)prop-2-enoyl]-methylamino]ethyl]benzimidazol-2-yl]-5-(difluoromethyl)thiophene-2-carboxamide |
| SMILES | CN(CCn1c(NC(=O)c2ccc(C(F)F)s2)nc2ccccc21)C(=O)/C(C#N)=C/SCC(C)(C)C |
| InChI | InChI=1S/C25H27F2N5O2S2/c1-25(2,3)15-35-14-16(13-28)23(34)31(4)11-12-32-18-8-6-5-7-17(18)29-24(32)30-22(33)20-10-9-19(36-20)21(26)27/h5-10,14,21H,11-12,15H2,1-4H3,(H,29,30,33)/b16-14+ |
| InChIKey | OLDSDRLXAQWMIQ-JQIJEIRASA-N |
| XLogP | 5.93 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|