About CID 126604063
CID 126604063 (PubChem CID 126604063) has the molecular formula CH3OS4-
and a molecular weight of 159.30 g/mol.
Molecular Properties
| Compound Name | CID 126604063 |
| PubChem CID | 126604063 |
| Molecular Formula | CH3OS4- |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 158.91 |
| IUPAC Name | — |
| SMILES | COS[S-](=S)=S |
| InChI | InChI=1S/CH3OS4/c1-2-5-6(3)4/h1H3/q-1 |
| InChIKey | NNRPEUZVXHEOIQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 126604063 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 126604063?
The IUPAC name of CID 126604063 (CID 126604063) is not available.
What is the SMILES notation for CID 126604063?
The canonical SMILES for CID 126604063 is COS[S-](=S)=S.
What is the InChIKey of CID 126604063?
The InChIKey is NNRPEUZVXHEOIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3OS4/c1-2-5-6(3)4/h1H3/q-1.
What are the key properties of CID 126604063?
CID 126604063 has a molecular weight of 159.30 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 126604063 is sourced from PubChem (CID 126604063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).