About 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole
2,5-bis(2-iodopropan-2-yl)-1,3-thiazole (PubChem CID 126604102) has the molecular formula C9H13I2NS
and a molecular weight of 421.09 g/mol. Its IUPAC name is 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole |
| PubChem CID | 126604102 |
| Molecular Formula | C9H13I2NS |
| Molecular Weight | 421.09 g/mol |
| Exact Mass | 420.89 |
| IUPAC Name | 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole |
| SMILES | CC(C)(I)c1cnc(C(C)(C)I)s1 |
| InChI | InChI=1S/C9H13I2NS/c1-8(2,10)6-5-12-7(13-6)9(3,4)11/h5H,1-4H3 |
| InChIKey | MGQRPXBOKHVMIN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.09 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole?
The IUPAC name of 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole (CID 126604102) is 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole.
What is the SMILES notation for 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole?
The canonical SMILES for 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole is CC(C)(I)c1cnc(C(C)(C)I)s1.
What is the InChIKey of 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole?
The InChIKey is MGQRPXBOKHVMIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13I2NS/c1-8(2,10)6-5-12-7(13-6)9(3,4)11/h5H,1-4H3.
What are the key properties of 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole?
2,5-bis(2-iodopropan-2-yl)-1,3-thiazole has a molecular weight of 421.09 g/mol, XLogP of 4.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(2-iodopropan-2-yl)-1,3-thiazole is sourced from PubChem (CID 126604102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).