About (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane
(6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane (PubChem CID 126604336) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane.
Molecular Properties
| Compound Name | (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane |
| PubChem CID | 126604336 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane |
| SMILES | C=C/C=C1/SCCNC/C1=C/C |
| InChI | InChI=1S/C10H15NS/c1-3-5-10-9(4-2)8-11-6-7-12-10/h3-5,11H,1,6-8H2,2H3/b9-4-,10-5+ |
| InChIKey | JGPUUHNQJAPKLZ-DHPVUTNOSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane?
The IUPAC name of (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane (CID 126604336) is (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane.
What is the SMILES notation for (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane?
The canonical SMILES for (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane is C=C/C=C1/SCCNC/C1=C/C.
What is the InChIKey of (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane?
The InChIKey is JGPUUHNQJAPKLZ-DHPVUTNOSA-N. The full InChI is InChI=1S/C10H15NS/c1-3-5-10-9(4-2)8-11-6-7-12-10/h3-5,11H,1,6-8H2,2H3/b9-4-,10-5+.
What are the key properties of (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane?
(6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane has a molecular weight of 181.30 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z,7E)-6-ethylidene-7-prop-2-enylidene-1,4-thiazepane is sourced from PubChem (CID 126604336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).