C9H15NS — CID 126604338
(6Z,7E)-6,7-di(ethylidene)-1,4-thiazepane (PubChem CID 126604338) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is (6Z,7E)-6,7-di(ethylidene)-1,4-thiazepane.
| Compound Name | (6Z,7E)-6,7-di(ethylidene)-1,4-thiazepane |
|---|---|
| PubChem CID | 126604338 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (6Z,7E)-6,7-di(ethylidene)-1,4-thiazepane |
| SMILES | C/C=C1/CNCCS/C1=C/C |
| InChI | InChI=1S/C9H15NS/c1-3-8-7-10-5-6-11-9(8)4-2/h3-4,10H,5-7H2,1-2H3/b8-3-,9-4+ |
| InChIKey | YDGUISCSUYLAKO-SNXNNQDSSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |