C11H15NS — CID 126604347
(6Z,7E)-6,7-bis(prop-2-enylidene)-1,4-thiazepane (PubChem CID 126604347) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is (6Z,7E)-6,7-bis(prop-2-enylidene)-1,4-thiazepane.
| Compound Name | (6Z,7E)-6,7-bis(prop-2-enylidene)-1,4-thiazepane |
|---|---|
| PubChem CID | 126604347 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (6Z,7E)-6,7-bis(prop-2-enylidene)-1,4-thiazepane |
| SMILES | C=C/C=C1/CNCCS/C1=C/C=C |
| InChI | InChI=1S/C11H15NS/c1-3-5-10-9-12-7-8-13-11(10)6-4-2/h3-6,12H,1-2,7-9H2/b10-5-,11-6+ |
| InChIKey | KKLWJPVYBLOHRG-JZKFVHIFSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |