C40H40N2 — CID 126604407
9-[4-[4-(1,2,4b,8a-tetrahydrocarbazol-9-yl)-2-methylphenyl]-3-methylphenyl]-2-ethyl-3,4,4b,8a-tetrahydrocarbazole (PubChem CID 126604407) has the molecular formula C40H40N2 and a molecular weight of 548.77 g/mol. Its IUPAC name is 9-[4-[4-(1,2,4b,8a-tetrahydrocarbazol-9-yl)-2-methylphenyl]-3-methylphenyl]-2-ethyl-3,4,4b,8a-tetrahydrocarbazole.
| Compound Name | 9-[4-[4-(1,2,4b,8a-tetrahydrocarbazol-9-yl)-2-methylphenyl]-3-methylphenyl]-2-ethyl-3,4,4b,8a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 126604407 |
| Molecular Formula | C40H40N2 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | 9-[4-[4-(1,2,4b,8a-tetrahydrocarbazol-9-yl)-2-methylphenyl]-3-methylphenyl]-2-ethyl-3,4,4b,8a-tetrahydrocarbazole |
| SMILES | CCC1=CC2=C(CC1)C1C=CC=CC1N2c1ccc(-c2ccc(N3C4=C(C=CCC4)C4C=CC=CC43)cc2C)c(C)c1 |
| InChI | InChI=1S/C40H40N2/c1-4-28-17-20-36-35-13-7-10-16-39(35)42(40(36)25-28)30-19-22-32(27(3)24-30)31-21-18-29(23-26(31)2)41-37-14-8-5-11-33(37)34-12-6-9-15-38(34)41/h5-8,10-14,16,18-19,21-25,33,35,37,39H,4,9,15,17,20H2,1-3H3 |
| InChIKey | RGWJZKXDECFBBM-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |