C16H14O2S — CID 126604517
14-methoxy-9-thiatricyclo[9.5.0.03,8]hexadeca-1(11),3,5,7,12,14-hexaen-2-one (PubChem CID 126604517) has the molecular formula C16H14O2S and a molecular weight of 270.35 g/mol. Its IUPAC name is 14-methoxy-9-thiatricyclo[9.5.0.03,8]hexadeca-1(11),3,5,7,12,14-hexaen-2-one.
| Compound Name | 14-methoxy-9-thiatricyclo[9.5.0.03,8]hexadeca-1(11),3,5,7,12,14-hexaen-2-one |
|---|---|
| PubChem CID | 126604517 |
| Molecular Formula | C16H14O2S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 14-methoxy-9-thiatricyclo[9.5.0.03,8]hexadeca-1(11),3,5,7,12,14-hexaen-2-one |
| SMILES | COC1=CCC2=C(C=C1)CSc1ccccc1C2=O |
| InChI | InChI=1S/C16H14O2S/c1-18-12-7-6-11-10-19-15-5-3-2-4-14(15)16(17)13(11)9-8-12/h2-8H,9-10H2,1H3 |
| InChIKey | OONXHQFKUTZNCP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |