About 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine
6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine (PubChem CID 126604775) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine.
Molecular Properties
| Compound Name | 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine |
| PubChem CID | 126604775 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine |
| SMILES | CN1CCN(C2=CC(N)=CCC=C2)CC1 |
| InChI | InChI=1S/C12H19N3/c1-14-6-8-15(9-7-14)12-5-3-2-4-11(13)10-12/h3-5,10H,2,6-9,13H2,1H3 |
| InChIKey | MGPUUXVSWODYST-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine?
The IUPAC name of 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine (CID 126604775) is 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine.
What is the SMILES notation for 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine?
The canonical SMILES for 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine is CN1CCN(C2=CC(N)=CCC=C2)CC1.
What is the InChIKey of 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine?
The InChIKey is MGPUUXVSWODYST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-14-6-8-15(9-7-14)12-5-3-2-4-11(13)10-12/h3-5,10H,2,6-9,13H2,1H3.
What are the key properties of 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine?
6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine has a molecular weight of 205.31 g/mol, XLogP of 0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methylpiperazin-1-yl)cyclohepta-1,4,6-trien-1-amine is sourced from PubChem (CID 126604775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).