C18H30O2 — CID 126604840
[(3E,5Z)-hepta-1,3,5-trien-3-yl] 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 126604840) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is [(3E,5Z)-hepta-1,3,5-trien-3-yl] 2-tert-butyl-4,4-dimethylpentanoate.
| Compound Name | [(3E,5Z)-hepta-1,3,5-trien-3-yl] 2-tert-butyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 126604840 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | [(3E,5Z)-hepta-1,3,5-trien-3-yl] 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | C=C/C(=C\C=C/C)OC(=O)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H30O2/c1-9-11-12-14(10-2)20-16(19)15(18(6,7)8)13-17(3,4)5/h9-12,15H,2,13H2,1,3-8H3/b11-9-,14-12+ |
| InChIKey | CPGYIVSMSPTAQQ-ZUJJVJDASA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|