C21H39N — CID 126604912
3-tert-butyl-3,5,5-trimethyl-N-(5-methyl-4-methylidenehex-5-enyl)hex-1-en-2-amine (PubChem CID 126604912) has the molecular formula C21H39N and a molecular weight of 305.55 g/mol. Its IUPAC name is 3-tert-butyl-3,5,5-trimethyl-N-(5-methyl-4-methylidenehex-5-enyl)hex-1-en-2-amine.
| Compound Name | 3-tert-butyl-3,5,5-trimethyl-N-(5-methyl-4-methylidenehex-5-enyl)hex-1-en-2-amine |
|---|---|
| PubChem CID | 126604912 |
| Molecular Formula | C21H39N |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 305.31 |
| IUPAC Name | 3-tert-butyl-3,5,5-trimethyl-N-(5-methyl-4-methylidenehex-5-enyl)hex-1-en-2-amine |
| SMILES | C=C(C)C(=C)CCCNC(=C)C(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H39N/c1-16(2)17(3)13-12-14-22-18(4)21(11,20(8,9)10)15-19(5,6)7/h22H,1,3-4,12-15H2,2,5-11H3 |
| InChIKey | AQGBZPGAWCAWIN-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|