About 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one
7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one (PubChem CID 126604946) has the molecular formula C22H22O5
and a molecular weight of 366.41 g/mol. Its IUPAC name is 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one.
Molecular Properties
| Compound Name | 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one |
| PubChem CID | 126604946 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one |
| SMILES | C=CC(=O)CCC(O)COC1=CC2OC(=O)C(c3ccccc3)=CC2C=C1 |
| InChI | InChI=1S/C22H22O5/c1-2-17(23)9-10-18(24)14-26-19-11-8-16-12-20(15-6-4-3-5-7-15)22(25)27-21(16)13-19/h2-8,11-13,16,18,21,24H,1,9-10,14H2 |
| InChIKey | ZWWYUWGWLJSXGJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one?
The IUPAC name of 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one (CID 126604946) is 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one.
What is the SMILES notation for 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one?
The canonical SMILES for 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one is C=CC(=O)CCC(O)COC1=CC2OC(=O)C(c3ccccc3)=CC2C=C1.
What is the InChIKey of 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one?
The InChIKey is ZWWYUWGWLJSXGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O5/c1-2-17(23)9-10-18(24)14-26-19-11-8-16-12-20(15-6-4-3-5-7-15)22(25)27-21(16)13-19/h2-8,11-13,16,18,21,24H,1,9-10,14H2.
What are the key properties of 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one?
7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one has a molecular weight of 366.41 g/mol, XLogP of 2.98, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-hydroxy-5-oxohept-6-enoxy)-3-phenyl-4a,8a-dihydrochromen-2-one is sourced from PubChem (CID 126604946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).