About N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide
N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide (PubChem CID 126605000) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide.
Molecular Properties
| Compound Name | N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide |
| PubChem CID | 126605000 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide |
| SMILES | COC(/C=C(/C)NC=O)=C(/C)CN |
| InChI | InChI=1S/C9H16N2O2/c1-7(5-10)9(13-3)4-8(2)11-6-12/h4,6H,5,10H2,1-3H3,(H,11,12)/b8-4-,9-7- |
| InChIKey | WHMXCLKRJFSYPF-CKCLTMHVSA-N |
| XLogP | 0.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide?
The IUPAC name of N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide (CID 126605000) is N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide.
What is the SMILES notation for N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide?
The canonical SMILES for N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide is COC(/C=C(/C)NC=O)=C(/C)CN.
What is the InChIKey of N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide?
The InChIKey is WHMXCLKRJFSYPF-CKCLTMHVSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-7(5-10)9(13-3)4-8(2)11-6-12/h4,6H,5,10H2,1-3H3,(H,11,12)/b8-4-,9-7-.
What are the key properties of N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide?
N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide has a molecular weight of 184.24 g/mol, XLogP of 0.52, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z,4Z)-6-amino-4-methoxy-5-methylhexa-2,4-dien-2-yl]formamide is sourced from PubChem (CID 126605000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).