C35H64O9 — CID 126605357
2-[3-heptanoyloxy-2,2-bis(heptanoyloxymethyl)propoxy]ethyl heptanoate (PubChem CID 126605357) has the molecular formula C35H64O9 and a molecular weight of 628.89 g/mol. Its IUPAC name is 2-[3-heptanoyloxy-2,2-bis(heptanoyloxymethyl)propoxy]ethyl heptanoate.
| Compound Name | 2-[3-heptanoyloxy-2,2-bis(heptanoyloxymethyl)propoxy]ethyl heptanoate |
|---|---|
| PubChem CID | 126605357 |
| Molecular Formula | C35H64O9 |
| Molecular Weight | 628.89 g/mol |
| Exact Mass | 628.46 |
| IUPAC Name | 2-[3-heptanoyloxy-2,2-bis(heptanoyloxymethyl)propoxy]ethyl heptanoate |
| SMILES | CCCCCCC(=O)OCCOCC(COC(=O)CCCCCC)(COC(=O)CCCCCC)COC(=O)CCCCCC |
| InChI | InChI=1S/C35H64O9/c1-5-9-13-17-21-31(36)41-26-25-40-27-35(28-42-32(37)22-18-14-10-6-2,29-43-33(38)23-19-15-11-7-3)30-44-34(39)24-20-16-12-8-4/h5-30H2,1-4H3 |
| InChIKey | FMAXDKMQGBOQLT-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.89 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|