About 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine
8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine (PubChem CID 126605441) has the molecular formula C20H24N6O2S
and a molecular weight of 412.52 g/mol. Its IUPAC name is 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine.
Molecular Properties
| Compound Name | 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
| PubChem CID | 126605441 |
| Molecular Formula | C20H24N6O2S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
| SMILES | C=Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCCNC(C)C)OCO2 |
| InChI | InChI=1S/C20H24N6O2S/c1-4-13-8-14-15(28-11-27-14)9-16(13)29-20-25-17-18(21)23-10-24-19(17)26(20)7-5-6-22-12(2)3/h4,8-10,12,22H,1,5-7,11H2,2-3H3,(H2,21,23,24) |
| InChIKey | BOBKJSRGHTUGNX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine?
The IUPAC name of 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine (CID 126605441) is 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine.
What is the SMILES notation for 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine?
The canonical SMILES for 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine is C=Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCCNC(C)C)OCO2.
What is the InChIKey of 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine?
The InChIKey is BOBKJSRGHTUGNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6O2S/c1-4-13-8-14-15(28-11-27-14)9-16(13)29-20-25-17-18(21)23-10-24-19(17)26(20)7-5-6-22-12(2)3/h4,8-10,12,22H,1,5-7,11H2,2-3H3,(H2,21,23,24).
What are the key properties of 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine?
8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine has a molecular weight of 412.52 g/mol, XLogP of 3.32, 8 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(6-ethenyl-1,3-benzodioxol-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine is sourced from PubChem (CID 126605441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).