About [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite
[2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite (PubChem CID 126605827) has the molecular formula C13H16BrFN4OS
and a molecular weight of 375.27 g/mol. Its IUPAC name is [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite |
| PubChem CID | 126605827 |
| Molecular Formula | C13H16BrFN4OS |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite |
| SMILES | CC(NC(=O)c1cn(SF)c2ncc(Br)nc12)C(C)(C)C |
| InChI | InChI=1S/C13H16BrFN4OS/c1-7(13(2,3)4)17-12(20)8-6-19(21-15)11-10(8)18-9(14)5-16-11/h5-7H,1-4H3,(H,17,20) |
| InChIKey | CZGDHYONQGXKIP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite?
The IUPAC name of [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite (CID 126605827) is [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite.
What is the SMILES notation for [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite?
The canonical SMILES for [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite is CC(NC(=O)c1cn(SF)c2ncc(Br)nc12)C(C)(C)C.
What is the InChIKey of [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite?
The InChIKey is CZGDHYONQGXKIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrFN4OS/c1-7(13(2,3)4)17-12(20)8-6-19(21-15)11-10(8)18-9(14)5-16-11/h5-7H,1-4H3,(H,17,20).
What are the key properties of [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite?
[2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite has a molecular weight of 375.27 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-bromo-7-(3,3-dimethylbutan-2-ylcarbamoyl)pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite is sourced from PubChem (CID 126605827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).